C26H35ClN2O3 — CID 57413552
(2R)-1-[4-[[3-[(E)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]hexan-2-ol (PubChem CID 57413552) has the molecular formula C26H35ClN2O3 and a molecular weight of 459.03 g/mol. Its IUPAC name is (2R)-1-[4-[[3-[(E)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]hexan-2-ol.
| Compound Name | (2R)-1-[4-[[3-[(E)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]hexan-2-ol |
|---|---|
| PubChem CID | 57413552 |
| Molecular Formula | C26H35ClN2O3 |
| Molecular Weight | 459.03 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | (2R)-1-[4-[[3-[(E)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]hexan-2-ol |
| SMILES | CCCC[C@@H](O)CN1CCC(COc2cccc(/C(=N/OC)c3ccc(Cl)cc3)c2)CC1 |
| InChI | InChI=1S/C26H35ClN2O3/c1-3-4-7-24(30)18-29-15-13-20(14-16-29)19-32-25-8-5-6-22(17-25)26(28-31-2)21-9-11-23(27)12-10-21/h5-6,8-12,17,20,24,30H,3-4,7,13-16,18-19H2,1-2H3/b28-26+/t24-/m1/s1 |
| InChIKey | VHGHCZSBBSWQHI-KXYXFYQNSA-N |
| XLogP | 5.38 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.03 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|