C25H32ClNO3 — CID 57412924
(4-chlorophenyl)-[3-[[1-[(2S)-2-hydroxyhexyl]piperidin-4-yl]methoxy]phenyl]methanone (PubChem CID 57412924) has the molecular formula C25H32ClNO3 and a molecular weight of 429.99 g/mol. Its IUPAC name is (4-chlorophenyl)-[3-[[1-[(2S)-2-hydroxyhexyl]piperidin-4-yl]methoxy]phenyl]methanone.
| Compound Name | (4-chlorophenyl)-[3-[[1-[(2S)-2-hydroxyhexyl]piperidin-4-yl]methoxy]phenyl]methanone |
|---|---|
| PubChem CID | 57412924 |
| Molecular Formula | C25H32ClNO3 |
| Molecular Weight | 429.99 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | (4-chlorophenyl)-[3-[[1-[(2S)-2-hydroxyhexyl]piperidin-4-yl]methoxy]phenyl]methanone |
| SMILES | CCCC[C@H](O)CN1CCC(COc2cccc(C(=O)c3ccc(Cl)cc3)c2)CC1 |
| InChI | InChI=1S/C25H32ClNO3/c1-2-3-6-23(28)17-27-14-12-19(13-15-27)18-30-24-7-4-5-21(16-24)25(29)20-8-10-22(26)11-9-20/h4-5,7-11,16,19,23,28H,2-3,6,12-15,17-18H2,1H3/t23-/m0/s1 |
| InChIKey | SRLPHDVDVZJJJW-QHCPKHFHSA-N |
| XLogP | 5.21 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.99 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |