C37H47ClN2O4 — CID 57412577
[(1S)-1-[3-[[4-[[3-[(E)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]methyl]phenyl]octyl] acetate (PubChem CID 57412577) has the molecular formula C37H47ClN2O4 and a molecular weight of 619.25 g/mol. Its IUPAC name is [(1S)-1-[3-[[4-[[3-[(E)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]methyl]phenyl]octyl] acetate.
| Compound Name | [(1S)-1-[3-[[4-[[3-[(E)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]methyl]phenyl]octyl] acetate |
|---|---|
| PubChem CID | 57412577 |
| Molecular Formula | C37H47ClN2O4 |
| Molecular Weight | 619.25 g/mol |
| Exact Mass | 618.32 |
| IUPAC Name | [(1S)-1-[3-[[4-[[3-[(E)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]methyl]phenyl]octyl] acetate |
| SMILES | CCCCCCC[C@H](OC(C)=O)c1cccc(CN2CCC(COc3cccc(/C(=N/OC)c4ccc(Cl)cc4)c3)CC2)c1 |
| InChI | InChI=1S/C37H47ClN2O4/c1-4-5-6-7-8-15-36(44-28(2)41)32-12-9-11-30(24-32)26-40-22-20-29(21-23-40)27-43-35-14-10-13-33(25-35)37(39-42-3)31-16-18-34(38)19-17-31/h9-14,16-19,24-25,29,36H,4-8,15,20-23,26-27H2,1-3H3/b39-37+/t36-/m0/s1 |
| InChIKey | UPZXSBXYPKRLNO-FMQQBUJJSA-N |
| XLogP | 8.99 |
| TPSA | 60.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.25 |
| LogP ≤ 5 | 8.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|