C29H39Cl2N3O4 — CID 57413372
[(2R)-1-[4-[[3-chloro-4-[(E)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]octan-2-yl] carbamate (PubChem CID 57413372) has the molecular formula C29H39Cl2N3O4 and a molecular weight of 564.55 g/mol. Its IUPAC name is [(2R)-1-[4-[[3-chloro-4-[(E)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]octan-2-yl] carbamate.
| Compound Name | [(2R)-1-[4-[[3-chloro-4-[(E)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]octan-2-yl] carbamate |
|---|---|
| PubChem CID | 57413372 |
| Molecular Formula | C29H39Cl2N3O4 |
| Molecular Weight | 564.55 g/mol |
| Exact Mass | 563.23 |
| IUPAC Name | [(2R)-1-[4-[[3-chloro-4-[(E)-C-(4-chlorophenyl)-N-methoxycarbonimidoyl]phenoxy]methyl]piperidin-1-yl]octan-2-yl] carbamate |
| SMILES | CCCCCC[C@H](CN1CCC(COc2ccc(/C(=N/OC)c3ccc(Cl)cc3)c(Cl)c2)CC1)OC(N)=O |
| InChI | InChI=1S/C29H39Cl2N3O4/c1-3-4-5-6-7-25(38-29(32)35)19-34-16-14-21(15-17-34)20-37-24-12-13-26(27(31)18-24)28(33-36-2)22-8-10-23(30)11-9-22/h8-13,18,21,25H,3-7,14-17,19-20H2,1-2H3,(H2,32,35)/b33-28+/t25-/m1/s1 |
| InChIKey | VOEJKZSCBPKDQB-NQXBXTBESA-N |
| XLogP | 6.92 |
| TPSA | 86.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.55 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|