About benzo[e][1,3]benzothiazol-5-ol
benzo[e][1,3]benzothiazol-5-ol (PubChem CID 57422148) has the molecular formula C11H7NOS
and a molecular weight of 201.25 g/mol. Its IUPAC name is benzo[e][1,3]benzothiazol-5-ol.
Molecular Properties
| Compound Name | benzo[e][1,3]benzothiazol-5-ol |
| PubChem CID | 57422148 |
| Molecular Formula | C11H7NOS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | benzo[e][1,3]benzothiazol-5-ol |
| SMILES | Oc1cc2scnc2c2ccccc12 |
| InChI | InChI=1S/C11H7NOS/c13-9-5-10-11(12-6-14-10)8-4-2-1-3-7(8)9/h1-6,13H |
| InChIKey | PXYZPXCXVPXKAJ-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzo[e][1,3]benzothiazol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[e][1,3]benzothiazol-5-ol?
The IUPAC name of benzo[e][1,3]benzothiazol-5-ol (CID 57422148) is benzo[e][1,3]benzothiazol-5-ol.
What is the SMILES notation for benzo[e][1,3]benzothiazol-5-ol?
The canonical SMILES for benzo[e][1,3]benzothiazol-5-ol is Oc1cc2scnc2c2ccccc12.
What is the InChIKey of benzo[e][1,3]benzothiazol-5-ol?
The InChIKey is PXYZPXCXVPXKAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NOS/c13-9-5-10-11(12-6-14-10)8-4-2-1-3-7(8)9/h1-6,13H.
What are the key properties of benzo[e][1,3]benzothiazol-5-ol?
benzo[e][1,3]benzothiazol-5-ol has a molecular weight of 201.25 g/mol, XLogP of 3.16, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[e][1,3]benzothiazol-5-ol is sourced from PubChem (CID 57422148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).