C16H9Cl4NS — CID 57435542
2-(chloromethyl)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-1,3-thiazole (PubChem CID 57435542) has the molecular formula C16H9Cl4NS and a molecular weight of 389.13 g/mol. Its IUPAC name is 2-(chloromethyl)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-1,3-thiazole.
| Compound Name | 2-(chloromethyl)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 57435542 |
| Molecular Formula | C16H9Cl4NS |
| Molecular Weight | 389.13 g/mol |
| Exact Mass | 386.92 |
| IUPAC Name | 2-(chloromethyl)-4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-1,3-thiazole |
| SMILES | ClCc1nc(-c2ccc(Cl)cc2)c(-c2ccc(Cl)cc2Cl)s1 |
| InChI | InChI=1S/C16H9Cl4NS/c17-8-14-21-15(9-1-3-10(18)4-2-9)16(22-14)12-6-5-11(19)7-13(12)20/h1-7H,8H2 |
| InChIKey | UNIKKVAZTFWSQU-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.13 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|