C19H24N8O2 — CID 57472233
[2-[[[5-[(2-aminocyclohexyl)amino]-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]phenyl] acetate (PubChem CID 57472233) has the molecular formula C19H24N8O2 and a molecular weight of 396.46 g/mol. Its IUPAC name is [2-[[[5-[(2-aminocyclohexyl)amino]-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]phenyl] acetate.
| Compound Name | [2-[[[5-[(2-aminocyclohexyl)amino]-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]phenyl] acetate |
|---|---|
| PubChem CID | 57472233 |
| Molecular Formula | C19H24N8O2 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | [2-[[[5-[(2-aminocyclohexyl)amino]-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccccc1CNc1nc(NC2CCCCC2N)nc2n[nH]nc12 |
| InChI | InChI=1S/C19H24N8O2/c1-11(28)29-15-9-5-2-6-12(15)10-21-17-16-18(26-27-25-16)24-19(23-17)22-14-8-4-3-7-13(14)20/h2,5-6,9,13-14H,3-4,7-8,10,20H2,1H3,(H3,21,22,23,24,25,26,27) |
| InChIKey | CHIWVGODKISLCY-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 143.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|