C18H24N8O3 — CID 57472209
2-[[[5-[(4-aminocyclohexyl)amino]-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-5-methoxybenzene-1,4-diol (PubChem CID 57472209) has the molecular formula C18H24N8O3 and a molecular weight of 400.44 g/mol. Its IUPAC name is 2-[[[5-[(4-aminocyclohexyl)amino]-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-5-methoxybenzene-1,4-diol.
| Compound Name | 2-[[[5-[(4-aminocyclohexyl)amino]-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-5-methoxybenzene-1,4-diol |
|---|---|
| PubChem CID | 57472209 |
| Molecular Formula | C18H24N8O3 |
| Molecular Weight | 400.44 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | 2-[[[5-[(4-aminocyclohexyl)amino]-2H-triazolo[4,5-d]pyrimidin-7-yl]amino]methyl]-5-methoxybenzene-1,4-diol |
| SMILES | COc1cc(O)c(CNc2nc(NC3CCC(N)CC3)nc3n[nH]nc23)cc1O |
| InChI | InChI=1S/C18H24N8O3/c1-29-14-7-12(27)9(6-13(14)28)8-20-16-15-17(25-26-24-15)23-18(22-16)21-11-4-2-10(19)3-5-11/h6-7,10-11,27-28H,2-5,8,19H2,1H3,(H3,20,21,22,23,24,25,26) |
| InChIKey | BFCKJTBAUYMSOY-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 167.12 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|