About 1-aminohexyl thiocyanate
1-aminohexyl thiocyanate (PubChem CID 57473016) has the molecular formula C7H14N2S
and a molecular weight of 158.27 g/mol. Its IUPAC name is 1-aminohexyl thiocyanate.
Molecular Properties
| Compound Name | 1-aminohexyl thiocyanate |
| PubChem CID | 57473016 |
| Molecular Formula | C7H14N2S |
| Molecular Weight | 158.27 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | 1-aminohexyl thiocyanate |
| SMILES | CCCCCC(N)SC#N |
| InChI | InChI=1S/C7H14N2S/c1-2-3-4-5-7(9)10-6-8/h7H,2-5,9H2,1H3 |
| InChIKey | MNRKZPZGSCMAQQ-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.27 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-aminohexyl thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminohexyl thiocyanate?
The IUPAC name of 1-aminohexyl thiocyanate (CID 57473016) is 1-aminohexyl thiocyanate.
What is the SMILES notation for 1-aminohexyl thiocyanate?
The canonical SMILES for 1-aminohexyl thiocyanate is CCCCCC(N)SC#N.
What is the InChIKey of 1-aminohexyl thiocyanate?
The InChIKey is MNRKZPZGSCMAQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2S/c1-2-3-4-5-7(9)10-6-8/h7H,2-5,9H2,1H3.
What are the key properties of 1-aminohexyl thiocyanate?
1-aminohexyl thiocyanate has a molecular weight of 158.27 g/mol, XLogP of 2.07, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminohexyl thiocyanate is sourced from PubChem (CID 57473016), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).