C32H48N2O3Si — CID 57486751
ethyl 2-[[2-methyl-1-[[3-propan-2-yl-4-tri(propan-2-yl)silyloxyphenyl]methyl]indol-4-yl]amino]acetate (PubChem CID 57486751) has the molecular formula C32H48N2O3Si and a molecular weight of 536.83 g/mol. Its IUPAC name is ethyl 2-[[2-methyl-1-[[3-propan-2-yl-4-tri(propan-2-yl)silyloxyphenyl]methyl]indol-4-yl]amino]acetate.
| Compound Name | ethyl 2-[[2-methyl-1-[[3-propan-2-yl-4-tri(propan-2-yl)silyloxyphenyl]methyl]indol-4-yl]amino]acetate |
|---|---|
| PubChem CID | 57486751 |
| Molecular Formula | C32H48N2O3Si |
| Molecular Weight | 536.83 g/mol |
| Exact Mass | 536.34 |
| IUPAC Name | ethyl 2-[[2-methyl-1-[[3-propan-2-yl-4-tri(propan-2-yl)silyloxyphenyl]methyl]indol-4-yl]amino]acetate |
| SMILES | CCOC(=O)CNc1cccc2c1cc(C)n2Cc1ccc(O[Si](C(C)C)(C(C)C)C(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C32H48N2O3Si/c1-11-36-32(35)19-33-29-13-12-14-30-28(29)17-25(10)34(30)20-26-15-16-31(27(18-26)21(2)3)37-38(22(4)5,23(6)7)24(8)9/h12-18,21-24,33H,11,19-20H2,1-10H3 |
| InChIKey | GOYUMVNHLYIUHJ-UHFFFAOYSA-N |
| XLogP | 8.65 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.83 |
| LogP ≤ 5 | 8.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|