C11H18N2O4 — CID 58019697
(2,5-dioxopyrrolidin-1-yl) 6-(methylamino)hexanoate (PubChem CID 58019697) has the molecular formula C11H18N2O4 and a molecular weight of 242.27 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-(methylamino)hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-(methylamino)hexanoate |
|---|---|
| PubChem CID | 58019697 |
| Molecular Formula | C11H18N2O4 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-(methylamino)hexanoate |
| SMILES | CNCCCCCC(=O)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C11H18N2O4/c1-12-8-4-2-3-5-11(16)17-13-9(14)6-7-10(13)15/h12H,2-8H2,1H3 |
| InChIKey | YMFASFSHYMKHRC-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|