C11H18N3+ — CID 58070786
6,7-diaza-2-azoniatricyclo[6.6.0.02,6]tetradeca-1,7-diene (PubChem CID 58070786) has the molecular formula C11H18N3+ and a molecular weight of 192.29 g/mol. Its IUPAC name is 6,7-diaza-2-azoniatricyclo[6.6.0.02,6]tetradeca-1,7-diene.
| Compound Name | 6,7-diaza-2-azoniatricyclo[6.6.0.02,6]tetradeca-1,7-diene |
|---|---|
| PubChem CID | 58070786 |
| Molecular Formula | C11H18N3+ |
| Molecular Weight | 192.29 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | 6,7-diaza-2-azoniatricyclo[6.6.0.02,6]tetradeca-1,7-diene |
| SMILES | C1CCCc2c(nn3[n+]2CCC3)CC1 |
| InChI | InChI=1S/C11H18N3/c1-2-4-7-11-10(6-3-1)12-14-9-5-8-13(11)14/h1-9H2/q+1 |
| InChIKey | GFQKHMHGLDDUOM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.29 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|