C40H52N2O8PS+ — CID 58084000
CID 58084000 (PubChem CID 58084000) has the molecular formula C40H52N2O8PS+ and a molecular weight of 751.90 g/mol.
| Compound Name | CID 58084000 |
|---|---|
| PubChem CID | 58084000 |
| Molecular Formula | C40H52N2O8PS+ |
| Molecular Weight | 751.90 g/mol |
| Exact Mass | 751.32 |
| IUPAC Name | — |
| SMILES | [CH]CCCN1/C(=C\C=C\C=C\C2=[N+](CCCCC)c3ccccc3C2(C)CCCCCC(=O)O)C(C)(C(=C)P(=O)(O)O)c2cc(S(=O)(=O)O)ccc21 |
| InChI | InChI=1S/C40H51N2O8PS/c1-6-8-18-28-41-34-20-16-15-19-32(34)39(4,26-17-11-14-23-38(43)44)36(41)21-12-10-13-22-37-40(5,30(3)51(45,46)47)33-29-31(52(48,49)50)24-25-35(33)42(37)27-9-7-2/h2,10,12-13,15-16,19-22,24-25,29H,3,6-9,11,14,17-18,23,26-28H2,1,4-5H3,(H3-,43,44,45,46,47,48,49,50)/p+1 |
| InChIKey | SKMCZMOXBCWMPV-UHFFFAOYSA-O |
| XLogP | 8.47 |
| TPSA | 155.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.90 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|