C33H44ClN7O4 — CID 58100100
3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R,7S)-7-hydroxy-7-[4-hydroxy-3-(2-oxopropyl)phenyl]-4-methylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide (PubChem CID 58100100) has the molecular formula C33H44ClN7O4 and a molecular weight of 638.21 g/mol. Its IUPAC name is 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R,7S)-7-hydroxy-7-[4-hydroxy-3-(2-oxopropyl)phenyl]-4-methylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide.
| Compound Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R,7S)-7-hydroxy-7-[4-hydroxy-3-(2-oxopropyl)phenyl]-4-methylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 58100100 |
| Molecular Formula | C33H44ClN7O4 |
| Molecular Weight | 638.21 g/mol |
| Exact Mass | 637.31 |
| IUPAC Name | 3,5-diamino-6-chloro-N-[N'-[4-[4-[(4R,7S)-7-hydroxy-7-[4-hydroxy-3-(2-oxopropyl)phenyl]-4-methylheptyl]phenyl]butyl]carbamimidoyl]pyrazine-2-carboxamide |
| SMILES | CC(=O)Cc1cc([C@@H](O)CC[C@H](C)CCCc2ccc(CCCC/N=C(\N)NC(=O)c3nc(Cl)c(N)nc3N)cc2)ccc1O |
| InChI | InChI=1S/C33H44ClN7O4/c1-20(9-15-26(43)24-14-16-27(44)25(19-24)18-21(2)42)6-5-8-23-12-10-22(11-13-23)7-3-4-17-38-33(37)41-32(45)28-30(35)40-31(36)29(34)39-28/h10-14,16,19-20,26,43-44H,3-9,15,17-18H2,1-2H3,(H4,35,36,40)(H3,37,38,41,45)/t20-,26+/m1/s1 |
| InChIKey | JRPWEZXORGKSTB-IBVKSMDESA-N |
| XLogP | 4.67 |
| TPSA | 202.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.21 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|