C13H24O2S2 — CID 58105782
(2,3-dimethyl-1,4-dithiepan-2-yl) 2,2-dimethylbutanoate (PubChem CID 58105782) has the molecular formula C13H24O2S2 and a molecular weight of 276.47 g/mol. Its IUPAC name is (2,3-dimethyl-1,4-dithiepan-2-yl) 2,2-dimethylbutanoate.
| Compound Name | (2,3-dimethyl-1,4-dithiepan-2-yl) 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 58105782 |
| Molecular Formula | C13H24O2S2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (2,3-dimethyl-1,4-dithiepan-2-yl) 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C(=O)OC1(C)SCCCSC1C |
| InChI | InChI=1S/C13H24O2S2/c1-6-12(3,4)11(14)15-13(5)10(2)16-8-7-9-17-13/h10H,6-9H2,1-5H3 |
| InChIKey | SXUIEURYBUUUSD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |