C30H31Cl2N3O8 — CID 58112404
(3S)-4-[5-(2,6-dichlorophenyl)-1,3-oxazol-2-yl]-3-[[(2R,5S)-2,6-dimethyl-4-oxo-5-(phenylmethoxycarbonylamino)heptanoyl]amino]-4-oxobutanoic acid (PubChem CID 58112404) has the molecular formula C30H31Cl2N3O8 and a molecular weight of 632.50 g/mol. Its IUPAC name is (3S)-4-[5-(2,6-dichlorophenyl)-1,3-oxazol-2-yl]-3-[[(2R,5S)-2,6-dimethyl-4-oxo-5-(phenylmethoxycarbonylamino)heptanoyl]amino]-4-oxobutanoic acid.
| Compound Name | (3S)-4-[5-(2,6-dichlorophenyl)-1,3-oxazol-2-yl]-3-[[(2R,5S)-2,6-dimethyl-4-oxo-5-(phenylmethoxycarbonylamino)heptanoyl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 58112404 |
| Molecular Formula | C30H31Cl2N3O8 |
| Molecular Weight | 632.50 g/mol |
| Exact Mass | 631.15 |
| IUPAC Name | (3S)-4-[5-(2,6-dichlorophenyl)-1,3-oxazol-2-yl]-3-[[(2R,5S)-2,6-dimethyl-4-oxo-5-(phenylmethoxycarbonylamino)heptanoyl]amino]-4-oxobutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)OCc1ccccc1)C(=O)C[C@@H](C)C(=O)N[C@@H](CC(=O)O)C(=O)c1ncc(-c2c(Cl)cccc2Cl)o1 |
| InChI | InChI=1S/C30H31Cl2N3O8/c1-16(2)26(35-30(41)42-15-18-8-5-4-6-9-18)22(36)12-17(3)28(40)34-21(13-24(37)38)27(39)29-33-14-23(43-29)25-19(31)10-7-11-20(25)32/h4-11,14,16-17,21,26H,12-13,15H2,1-3H3,(H,34,40)(H,35,41)(H,37,38)/t17-,21+,26+/m1/s1 |
| InChIKey | QXOVBUUDFPKMCM-GLEILKSWSA-N |
| XLogP | 5.34 |
| TPSA | 164.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |