C22H29N3O3 — CID 58135607
methyl (2S)-3,3-dimethyl-2-[2-oxo-2-(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepin-1-yl)ethyl]butanoate (PubChem CID 58135607) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl (2S)-3,3-dimethyl-2-[2-oxo-2-(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepin-1-yl)ethyl]butanoate.
| Compound Name | methyl (2S)-3,3-dimethyl-2-[2-oxo-2-(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepin-1-yl)ethyl]butanoate |
|---|---|
| PubChem CID | 58135607 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | methyl (2S)-3,3-dimethyl-2-[2-oxo-2-(3-phenyl-6,7,8,9-tetrahydro-5H-imidazo[1,5-a][1,4]diazepin-1-yl)ethyl]butanoate |
| SMILES | COC(=O)[C@@H](CC(=O)c1nc(-c2ccccc2)n2c1CNCCC2)C(C)(C)C |
| InChI | InChI=1S/C22H29N3O3/c1-22(2,3)16(21(27)28-4)13-18(26)19-17-14-23-11-8-12-25(17)20(24-19)15-9-6-5-7-10-15/h5-7,9-10,16,23H,8,11-14H2,1-4H3/t16-/m1/s1 |
| InChIKey | DVBFLYPZXZBEIC-MRXNPFEDSA-N |
| XLogP | 3.45 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |