About bis(4-phenylpyridine);trichloroiridium
bis(4-phenylpyridine);trichloroiridium (PubChem CID 58162878) has the molecular formula C22H18Cl3IrN2
and a molecular weight of 608.98 g/mol. Its IUPAC name is bis(4-phenylpyridine);trichloroiridium.
Molecular Properties
| Compound Name | bis(4-phenylpyridine);trichloroiridium |
| PubChem CID | 58162878 |
| Molecular Formula | C22H18Cl3IrN2 |
| Molecular Weight | 608.98 g/mol |
| Exact Mass | 608.02 |
| IUPAC Name | bis(4-phenylpyridine);trichloroiridium |
| SMILES | Cl[Ir](Cl)Cl.c1ccc(-c2ccncc2)cc1.c1ccc(-c2ccncc2)cc1 |
| InChI | InChI=1S/2C11H9N.3ClH.Ir/c2*1-2-4-10(5-3-1)11-6-8-12-9-7-11;;;;/h2*1-9H;3*1H;/q;;;;;+3/p-3 |
| InChIKey | FUUURBYEPFLVML-UHFFFAOYSA-K |
| XLogP | 7.56 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 608.98 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(4-phenylpyridine);trichloroiridium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-phenylpyridine);trichloroiridium?
The IUPAC name of bis(4-phenylpyridine);trichloroiridium (CID 58162878) is bis(4-phenylpyridine);trichloroiridium.
What is the SMILES notation for bis(4-phenylpyridine);trichloroiridium?
The canonical SMILES for bis(4-phenylpyridine);trichloroiridium is Cl[Ir](Cl)Cl.c1ccc(-c2ccncc2)cc1.c1ccc(-c2ccncc2)cc1.
What is the InChIKey of bis(4-phenylpyridine);trichloroiridium?
The InChIKey is FUUURBYEPFLVML-UHFFFAOYSA-K. The full InChI is InChI=1S/2C11H9N.3ClH.Ir/c2*1-2-4-10(5-3-1)11-6-8-12-9-7-11;;;;/h2*1-9H;3*1H;/q;;;;;+3/p-3.
What are the key properties of bis(4-phenylpyridine);trichloroiridium?
bis(4-phenylpyridine);trichloroiridium has a molecular weight of 608.98 g/mol, XLogP of 7.56, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-phenylpyridine);trichloroiridium is sourced from PubChem (CID 58162878), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).