C18H26N8O3 — CID 58177496
(2R,5R)-5-(6-aminopurin-9-yl)-2-[[4-(1-hydroxyhexyl)triazol-1-yl]methyl]oxolan-3-ol (PubChem CID 58177496) has the molecular formula C18H26N8O3 and a molecular weight of 402.46 g/mol. Its IUPAC name is (2R,5R)-5-(6-aminopurin-9-yl)-2-[[4-(1-hydroxyhexyl)triazol-1-yl]methyl]oxolan-3-ol.
| Compound Name | (2R,5R)-5-(6-aminopurin-9-yl)-2-[[4-(1-hydroxyhexyl)triazol-1-yl]methyl]oxolan-3-ol |
|---|---|
| PubChem CID | 58177496 |
| Molecular Formula | C18H26N8O3 |
| Molecular Weight | 402.46 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | (2R,5R)-5-(6-aminopurin-9-yl)-2-[[4-(1-hydroxyhexyl)triazol-1-yl]methyl]oxolan-3-ol |
| SMILES | CCCCCC(O)c1cn(C[C@H]2O[C@@H](n3cnc4c(N)ncnc43)CC2O)nn1 |
| InChI | InChI=1S/C18H26N8O3/c1-2-3-4-5-12(27)11-7-25(24-23-11)8-14-13(28)6-15(29-14)26-10-22-16-17(19)20-9-21-18(16)26/h7,9-10,12-15,27-28H,2-6,8H2,1H3,(H2,19,20,21)/t12?,13?,14-,15-/m1/s1 |
| InChIKey | BTEQVWJTIKZISH-NEXFUWMNSA-N |
| XLogP | 0.96 |
| TPSA | 150.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.46 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|