C19H23Cl2N3O6 — CID 58193228
(2S)-3-[6-(2,6-dichlorophenyl)-3-imino-5-oxohexanoyl]oxy-2-[[2-(methylamino)acetyl]amino]butanoic acid (PubChem CID 58193228) has the molecular formula C19H23Cl2N3O6 and a molecular weight of 460.31 g/mol. Its IUPAC name is (2S)-3-[6-(2,6-dichlorophenyl)-3-imino-5-oxohexanoyl]oxy-2-[[2-(methylamino)acetyl]amino]butanoic acid.
| Compound Name | (2S)-3-[6-(2,6-dichlorophenyl)-3-imino-5-oxohexanoyl]oxy-2-[[2-(methylamino)acetyl]amino]butanoic acid |
|---|---|
| PubChem CID | 58193228 |
| Molecular Formula | C19H23Cl2N3O6 |
| Molecular Weight | 460.31 g/mol |
| Exact Mass | 459.10 |
| IUPAC Name | (2S)-3-[6-(2,6-dichlorophenyl)-3-imino-5-oxohexanoyl]oxy-2-[[2-(methylamino)acetyl]amino]butanoic acid |
| SMILES | [H]/N=C(/CC(=O)Cc1c(Cl)cccc1Cl)CC(=O)OC(C)[C@H](NC(=O)CNC)C(=O)O |
| InChI | InChI=1S/C19H23Cl2N3O6/c1-10(18(19(28)29)24-16(26)9-23-2)30-17(27)7-11(22)6-12(25)8-13-14(20)4-3-5-15(13)21/h3-5,10,18,22-23H,6-9H2,1-2H3,(H,24,26)(H,28,29)/b22-11-/t10?,18-/m0/s1 |
| InChIKey | WXTUAHRLXFMLHD-IOMHKMQOSA-N |
| XLogP | 1.63 |
| TPSA | 145.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.31 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|