C19H22Cl2N2O6 — CID 58193270
(2S)-2-[[2-[6-(2,6-dichlorophenyl)-3-imino-5-oxohexanoyl]oxyacetyl]amino]-3-methylbutanoic acid (PubChem CID 58193270) has the molecular formula C19H22Cl2N2O6 and a molecular weight of 445.30 g/mol. Its IUPAC name is (2S)-2-[[2-[6-(2,6-dichlorophenyl)-3-imino-5-oxohexanoyl]oxyacetyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[2-[6-(2,6-dichlorophenyl)-3-imino-5-oxohexanoyl]oxyacetyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 58193270 |
| Molecular Formula | C19H22Cl2N2O6 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | (2S)-2-[[2-[6-(2,6-dichlorophenyl)-3-imino-5-oxohexanoyl]oxyacetyl]amino]-3-methylbutanoic acid |
| SMILES | [H]/N=C(/CC(=O)Cc1c(Cl)cccc1Cl)CC(=O)OCC(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C19H22Cl2N2O6/c1-10(2)18(19(27)28)23-16(25)9-29-17(26)7-11(22)6-12(24)8-13-14(20)4-3-5-15(13)21/h3-5,10,18,22H,6-9H2,1-2H3,(H,23,25)(H,27,28)/b22-11-/t18-/m0/s1 |
| InChIKey | LUOVITYHRWNQJQ-JGVLGKFESA-N |
| XLogP | 2.67 |
| TPSA | 133.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|