C21H28Cl2N4O5 — CID 58193215
(2S)-2-[[5-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3,3-dimethyl-5-oxopentanoyl]amino]-3-methylbutanoic acid (PubChem CID 58193215) has the molecular formula C21H28Cl2N4O5 and a molecular weight of 487.38 g/mol. Its IUPAC name is (2S)-2-[[5-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3,3-dimethyl-5-oxopentanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[5-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3,3-dimethyl-5-oxopentanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 58193215 |
| Molecular Formula | C21H28Cl2N4O5 |
| Molecular Weight | 487.38 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | (2S)-2-[[5-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3,3-dimethyl-5-oxopentanoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)CC(C)(C)CC(=O)/N=C(\N)NC(=O)Cc1c(Cl)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C21H28Cl2N4O5/c1-11(2)18(19(31)32)25-16(29)9-21(3,4)10-17(30)27-20(24)26-15(28)8-12-13(22)6-5-7-14(12)23/h5-7,11,18H,8-10H2,1-4H3,(H,25,29)(H,31,32)(H3,24,26,27,28,30)/t18-/m0/s1 |
| InChIKey | QIWQHFKJFADFPZ-SFHVURJKSA-N |
| XLogP | 2.53 |
| TPSA | 150.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.38 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|