C24H26Cl2N4O6 — CID 58193210
(2R,5R)-5-amino-2-[3-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3-oxopropyl]-6-(4-hydroxyphenyl)-4-oxohexanoic acid (PubChem CID 58193210) has the molecular formula C24H26Cl2N4O6 and a molecular weight of 537.40 g/mol. Its IUPAC name is (2R,5R)-5-amino-2-[3-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3-oxopropyl]-6-(4-hydroxyphenyl)-4-oxohexanoic acid.
| Compound Name | (2R,5R)-5-amino-2-[3-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3-oxopropyl]-6-(4-hydroxyphenyl)-4-oxohexanoic acid |
|---|---|
| PubChem CID | 58193210 |
| Molecular Formula | C24H26Cl2N4O6 |
| Molecular Weight | 537.40 g/mol |
| Exact Mass | 536.12 |
| IUPAC Name | (2R,5R)-5-amino-2-[3-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3-oxopropyl]-6-(4-hydroxyphenyl)-4-oxohexanoic acid |
| SMILES | N/C(=N\C(=O)CC[C@H](CC(=O)[C@H](N)Cc1ccc(O)cc1)C(=O)O)NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C24H26Cl2N4O6/c25-17-2-1-3-18(26)16(17)12-22(34)30-24(28)29-21(33)9-6-14(23(35)36)11-20(32)19(27)10-13-4-7-15(31)8-5-13/h1-5,7-8,14,19,31H,6,9-12,27H2,(H,35,36)(H3,28,29,30,33,34)/t14-,19-/m1/s1 |
| InChIKey | BVFMKCDKIRJKDS-AUUYWEPGSA-N |
| XLogP | 2.21 |
| TPSA | 185.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|