C18H22Cl2N4O5 — CID 58193311
(2R,5R)-5-amino-2-[3-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3-oxopropyl]-4-oxohexanoic acid (PubChem CID 58193311) has the molecular formula C18H22Cl2N4O5 and a molecular weight of 445.30 g/mol. Its IUPAC name is (2R,5R)-5-amino-2-[3-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3-oxopropyl]-4-oxohexanoic acid.
| Compound Name | (2R,5R)-5-amino-2-[3-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3-oxopropyl]-4-oxohexanoic acid |
|---|---|
| PubChem CID | 58193311 |
| Molecular Formula | C18H22Cl2N4O5 |
| Molecular Weight | 445.30 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | (2R,5R)-5-amino-2-[3-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3-oxopropyl]-4-oxohexanoic acid |
| SMILES | C[C@@H](N)C(=O)C[C@@H](CCC(=O)/N=C(\N)NC(=O)Cc1c(Cl)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C18H22Cl2N4O5/c1-9(21)14(25)7-10(17(28)29)5-6-15(26)23-18(22)24-16(27)8-11-12(19)3-2-4-13(11)20/h2-4,9-10H,5-8,21H2,1H3,(H,28,29)(H3,22,23,24,26,27)/t9-,10-/m1/s1 |
| InChIKey | VXDISYCCOIBDSG-NXEZZACHSA-N |
| XLogP | 1.28 |
| TPSA | 164.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.30 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|