C20H26Cl2N4O6 — CID 123489469
(2S,5S)-5-amino-2-[(1R)-1-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]carbamoyloxy]ethyl]-6-methyl-4-oxoheptanoic acid (PubChem CID 123489469) has the molecular formula C20H26Cl2N4O6 and a molecular weight of 489.36 g/mol. Its IUPAC name is (2S,5S)-5-amino-2-[(1R)-1-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]carbamoyloxy]ethyl]-6-methyl-4-oxoheptanoic acid.
| Compound Name | (2S,5S)-5-amino-2-[(1R)-1-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]carbamoyloxy]ethyl]-6-methyl-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 123489469 |
| Molecular Formula | C20H26Cl2N4O6 |
| Molecular Weight | 489.36 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | (2S,5S)-5-amino-2-[(1R)-1-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]carbamoyloxy]ethyl]-6-methyl-4-oxoheptanoic acid |
| SMILES | CC(C)[C@H](N)C(=O)C[C@H](C(=O)O)[C@@H](C)OC(=O)N=C(N)NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C20H26Cl2N4O6/c1-9(2)17(23)15(27)7-11(18(29)30)10(3)32-20(31)26-19(24)25-16(28)8-12-13(21)5-4-6-14(12)22/h4-6,9-11,17H,7-8,23H2,1-3H3,(H,29,30)(H3,24,25,26,28,31)/t10-,11+,17+/m1/s1 |
| InChIKey | FXPGHOMROFCJBE-RLFDGXBXSA-N |
| XLogP | 2.14 |
| TPSA | 174.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|