C17H21Cl2N3O8 — CID 77177259
(3,4,5-trihydroxy-6-methoxyoxan-2-yl)methyl N-[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]carbamate (PubChem CID 77177259) has the molecular formula C17H21Cl2N3O8 and a molecular weight of 466.27 g/mol. Its IUPAC name is (3,4,5-trihydroxy-6-methoxyoxan-2-yl)methyl N-[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]carbamate.
| Compound Name | (3,4,5-trihydroxy-6-methoxyoxan-2-yl)methyl N-[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]carbamate |
|---|---|
| PubChem CID | 77177259 |
| Molecular Formula | C17H21Cl2N3O8 |
| Molecular Weight | 466.27 g/mol |
| Exact Mass | 465.07 |
| IUPAC Name | (3,4,5-trihydroxy-6-methoxyoxan-2-yl)methyl N-[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]carbamate |
| SMILES | COC1OC(COC(=O)N=C(N)NC(=O)Cc2c(Cl)cccc2Cl)C(O)C(O)C1O |
| InChI | InChI=1S/C17H21Cl2N3O8/c1-28-15-14(26)13(25)12(24)10(30-15)6-29-17(27)22-16(20)21-11(23)5-7-8(18)3-2-4-9(7)19/h2-4,10,12-15,24-26H,5-6H2,1H3,(H3,20,21,22,23,27) |
| InChIKey | WHGAFOSLLQNGSN-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 172.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.27 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|