C19H24Cl2N4O5 — CID 58193243
(2S)-2-amino-10-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-5,10-dioxodecanoic acid (PubChem CID 58193243) has the molecular formula C19H24Cl2N4O5 and a molecular weight of 459.33 g/mol. Its IUPAC name is (2S)-2-amino-10-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-5,10-dioxodecanoic acid.
| Compound Name | (2S)-2-amino-10-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-5,10-dioxodecanoic acid |
|---|---|
| PubChem CID | 58193243 |
| Molecular Formula | C19H24Cl2N4O5 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | (2S)-2-amino-10-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-5,10-dioxodecanoic acid |
| SMILES | N/C(=N\C(=O)CCCCC(=O)CC[C@H](N)C(=O)O)NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H24Cl2N4O5/c20-13-5-3-6-14(21)12(13)10-17(28)25-19(23)24-16(27)7-2-1-4-11(26)8-9-15(22)18(29)30/h3,5-6,15H,1-2,4,7-10,22H2,(H,29,30)(H3,23,24,25,27,28)/t15-/m0/s1 |
| InChIKey | ZTEGVSKNLPIRTN-HNNXBMFYSA-N |
| XLogP | 1.82 |
| TPSA | 164.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|