C20H26Cl2N4O5 — CID 58193331
(2R,5R)-5-amino-2-[3-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3-oxopropyl]-6-methyl-4-oxoheptanoic acid (PubChem CID 58193331) has the molecular formula C20H26Cl2N4O5 and a molecular weight of 473.36 g/mol. Its IUPAC name is (2R,5R)-5-amino-2-[3-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3-oxopropyl]-6-methyl-4-oxoheptanoic acid.
| Compound Name | (2R,5R)-5-amino-2-[3-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3-oxopropyl]-6-methyl-4-oxoheptanoic acid |
|---|---|
| PubChem CID | 58193331 |
| Molecular Formula | C20H26Cl2N4O5 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | (2R,5R)-5-amino-2-[3-[[amino-[[2-(2,6-dichlorophenyl)acetyl]amino]methylidene]amino]-3-oxopropyl]-6-methyl-4-oxoheptanoic acid |
| SMILES | CC(C)[C@@H](N)C(=O)C[C@@H](CCC(=O)/N=C(\N)NC(=O)Cc1c(Cl)cccc1Cl)C(=O)O |
| InChI | InChI=1S/C20H26Cl2N4O5/c1-10(2)18(23)15(27)8-11(19(30)31)6-7-16(28)25-20(24)26-17(29)9-12-13(21)4-3-5-14(12)22/h3-5,10-11,18H,6-9,23H2,1-2H3,(H,30,31)(H3,24,25,26,28,29)/t11-,18-/m1/s1 |
| InChIKey | OSVARRXSAPCARY-ADLMAVQZSA-N |
| XLogP | 1.92 |
| TPSA | 164.94 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|