C18H25Cl2N5O3 — CID 173383152
(2R)-2-amino-N-[4-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-4-oxobutyl]-3-methylbutanamide (PubChem CID 173383152) has the molecular formula C18H25Cl2N5O3 and a molecular weight of 430.34 g/mol. Its IUPAC name is (2R)-2-amino-N-[4-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-4-oxobutyl]-3-methylbutanamide.
| Compound Name | (2R)-2-amino-N-[4-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-4-oxobutyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 173383152 |
| Molecular Formula | C18H25Cl2N5O3 |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.13 |
| IUPAC Name | (2R)-2-amino-N-[4-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-4-oxobutyl]-3-methylbutanamide |
| SMILES | [H]/N=C(\NC(=O)CCCNC(=O)[C@H](N)C(C)C)NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C18H25Cl2N5O3/c1-10(2)16(21)17(28)23-8-4-7-14(26)24-18(22)25-15(27)9-11-12(19)5-3-6-13(11)20/h3,5-6,10,16H,4,7-9,21H2,1-2H3,(H,23,28)(H3,22,24,25,26,27)/t16-/m1/s1 |
| InChIKey | JXTYRYMTIXZZKM-MRXNPFEDSA-N |
| XLogP | 1.58 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|