C18H25BClN5O3 — CID 173475171
CID 173475171 (PubChem CID 173475171) has the molecular formula C18H25BClN5O3 and a molecular weight of 405.70 g/mol.
| Compound Name | CID 173475171 |
|---|---|
| PubChem CID | 173475171 |
| Molecular Formula | C18H25BClN5O3 |
| Molecular Weight | 405.70 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | — |
| SMILES | [H]/N=C(\NC(=O)CCNC(=O)[C@@H](N[B])C(C)C)NC(=O)Cc1c(C)cccc1Cl |
| InChI | InChI=1S/C18H25BClN5O3/c1-10(2)16(25-19)17(28)22-8-7-14(26)23-18(21)24-15(27)9-12-11(3)5-4-6-13(12)20/h4-6,10,16,25H,7-9H2,1-3H3,(H,22,28)(H3,21,23,24,26,27)/t16-/m0/s1 |
| InChIKey | OLRZUVKIIPEJFJ-INIZCTEOSA-N |
| XLogP | 0.56 |
| TPSA | 123.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.70 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|