C19H24Cl2N4O5 — CID 173475174
2-[[5-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-5-oxopentanoyl]amino]-3-methylbutanoic acid (PubChem CID 173475174) has the molecular formula C19H24Cl2N4O5 and a molecular weight of 459.33 g/mol. Its IUPAC name is 2-[[5-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-5-oxopentanoyl]amino]-3-methylbutanoic acid.
| Compound Name | 2-[[5-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-5-oxopentanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 173475174 |
| Molecular Formula | C19H24Cl2N4O5 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | 2-[[5-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-5-oxopentanoyl]amino]-3-methylbutanoic acid |
| SMILES | [H]/N=C(\NC(=O)CCCC(=O)NC(C(=O)O)C(C)C)NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H24Cl2N4O5/c1-10(2)17(18(29)30)23-14(26)7-4-8-15(27)24-19(22)25-16(28)9-11-12(20)5-3-6-13(11)21/h3,5-6,10,17H,4,7-9H2,1-2H3,(H,23,26)(H,29,30)(H3,22,24,25,27,28) |
| InChIKey | NSRUCIGNPIHPON-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|