C19H24Cl2N4O5 — CID 173475167
(2S)-2-[[(2R)-4-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-2-methyl-4-oxobutanoyl]amino]-3-methylbutanoic acid (PubChem CID 173475167) has the molecular formula C19H24Cl2N4O5 and a molecular weight of 459.33 g/mol. Its IUPAC name is (2S)-2-[[(2R)-4-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-2-methyl-4-oxobutanoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(2R)-4-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-2-methyl-4-oxobutanoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 173475167 |
| Molecular Formula | C19H24Cl2N4O5 |
| Molecular Weight | 459.33 g/mol |
| Exact Mass | 458.11 |
| IUPAC Name | (2S)-2-[[(2R)-4-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-2-methyl-4-oxobutanoyl]amino]-3-methylbutanoic acid |
| SMILES | [H]/N=C(/NC(=O)Cc1c(Cl)cccc1Cl)NC(=O)C[C@@H](C)C(=O)N[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C19H24Cl2N4O5/c1-9(2)16(18(29)30)25-17(28)10(3)7-14(26)23-19(22)24-15(27)8-11-12(20)5-4-6-13(11)21/h4-6,9-10,16H,7-8H2,1-3H3,(H,25,28)(H,29,30)(H3,22,23,24,26,27)/t10-,16+/m1/s1 |
| InChIKey | KDTBGNQWRCDEKK-HWPZZCPQSA-N |
| XLogP | 1.95 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|