C19H25Cl2N5O5 — CID 173383162
(2S)-2-[(2-amino-3-methylbutanoyl)amino]-5-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-5-oxopentanoic acid (PubChem CID 173383162) has the molecular formula C19H25Cl2N5O5 and a molecular weight of 474.35 g/mol. Its IUPAC name is (2S)-2-[(2-amino-3-methylbutanoyl)amino]-5-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-5-oxopentanoic acid.
| Compound Name | (2S)-2-[(2-amino-3-methylbutanoyl)amino]-5-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 173383162 |
| Molecular Formula | C19H25Cl2N5O5 |
| Molecular Weight | 474.35 g/mol |
| Exact Mass | 473.12 |
| IUPAC Name | (2S)-2-[(2-amino-3-methylbutanoyl)amino]-5-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-5-oxopentanoic acid |
| SMILES | [H]/N=C(\NC(=O)CC[C@H](NC(=O)C(N)C(C)C)C(=O)O)NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C19H25Cl2N5O5/c1-9(2)16(22)17(29)24-13(18(30)31)6-7-14(27)25-19(23)26-15(28)8-10-11(20)4-3-5-12(10)21/h3-5,9,13,16H,6-8,22H2,1-2H3,(H,24,29)(H,30,31)(H3,23,25,26,27,28)/t13-,16?/m0/s1 |
| InChIKey | BVLKUMPLPUGETQ-KNVGNIICSA-N |
| XLogP | 1.04 |
| TPSA | 174.47 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.35 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|