C13H15Cl2N3O3 — CID 173007516
1,1,2,2-tetradeuteriopropyl N-[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]carbamate (PubChem CID 173007516) has the molecular formula C13H15Cl2N3O3 and a molecular weight of 336.21 g/mol. Its IUPAC name is 1,1,2,2-tetradeuteriopropyl N-[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]carbamate.
| Compound Name | 1,1,2,2-tetradeuteriopropyl N-[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 173007516 |
| Molecular Formula | C13H15Cl2N3O3 |
| Molecular Weight | 336.21 g/mol |
| Exact Mass | 335.07 |
| IUPAC Name | 1,1,2,2-tetradeuteriopropyl N-[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]carbamate |
| SMILES | [H]/N=C(/NC(=O)Cc1c(Cl)cccc1Cl)NC(=O)OC([2H])([2H])C([2H])([2H])C |
| InChI | InChI=1S/C13H15Cl2N3O3/c1-2-6-21-13(20)18-12(16)17-11(19)7-8-9(14)4-3-5-10(8)15/h3-5H,2,6-7H2,1H3,(H3,16,17,18,19,20)/i2D2,6D2 |
| InChIKey | HKBVUPVSSGMLDC-QLYAIYELSA-N |
| XLogP | 2.72 |
| TPSA | 91.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.21 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|