C17H23Cl2N5O3 — CID 140563343
(2S)-2-amino-N-[3-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-3-oxopropyl]-3-methylbutanamide (PubChem CID 140563343) has the molecular formula C17H23Cl2N5O3 and a molecular weight of 416.31 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-3-oxopropyl]-3-methylbutanamide.
| Compound Name | (2S)-2-amino-N-[3-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-3-oxopropyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 140563343 |
| Molecular Formula | C17H23Cl2N5O3 |
| Molecular Weight | 416.31 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (2S)-2-amino-N-[3-[[N-[2-(2,6-dichlorophenyl)acetyl]carbamimidoyl]amino]-3-oxopropyl]-3-methylbutanamide |
| SMILES | [H]/N=C(\NC(=O)CCNC(=O)[C@@H](N)C(C)C)NC(=O)Cc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C17H23Cl2N5O3/c1-9(2)15(20)16(27)22-7-6-13(25)23-17(21)24-14(26)8-10-11(18)4-3-5-12(10)19/h3-5,9,15H,6-8,20H2,1-2H3,(H,22,27)(H3,21,23,24,25,26)/t15-/m0/s1 |
| InChIKey | RVRZLKZBLDWBBZ-HNNXBMFYSA-N |
| XLogP | 1.19 |
| TPSA | 137.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|