C25H23ClN2O3 — CID 58208757
benzyl 2-[2-(2-chloro-4-phenyl-3-pyridinyl)acetyl]pyrrolidine-1-carboxylate (PubChem CID 58208757) has the molecular formula C25H23ClN2O3 and a molecular weight of 434.92 g/mol. Its IUPAC name is benzyl 2-[2-(2-chloro-4-phenyl-3-pyridinyl)acetyl]pyrrolidine-1-carboxylate.
| Compound Name | benzyl 2-[2-(2-chloro-4-phenyl-3-pyridinyl)acetyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 58208757 |
| Molecular Formula | C25H23ClN2O3 |
| Molecular Weight | 434.92 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | benzyl 2-[2-(2-chloro-4-phenyl-3-pyridinyl)acetyl]pyrrolidine-1-carboxylate |
| SMILES | O=C(Cc1c(-c2ccccc2)ccnc1Cl)C1CCCN1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C25H23ClN2O3/c26-24-21(20(13-14-27-24)19-10-5-2-6-11-19)16-23(29)22-12-7-15-28(22)25(30)31-17-18-8-3-1-4-9-18/h1-6,8-11,13-14,22H,7,12,15-17H2 |
| InChIKey | ICCOADIICFLQOZ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.92 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|