C19H20N4O2S — CID 58211241
4-[6-[[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonyl]-2-pyridinyl]benzonitrile (PubChem CID 58211241) has the molecular formula C19H20N4O2S and a molecular weight of 368.46 g/mol. Its IUPAC name is 4-[6-[[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonyl]-2-pyridinyl]benzonitrile.
| Compound Name | 4-[6-[[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonyl]-2-pyridinyl]benzonitrile |
|---|---|
| PubChem CID | 58211241 |
| Molecular Formula | C19H20N4O2S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-[6-[[(8aS)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]sulfonyl]-2-pyridinyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2cccc(S(=O)(=O)N3CCN4CCC[C@H]4C3)n2)cc1 |
| InChI | InChI=1S/C19H20N4O2S/c20-13-15-6-8-16(9-7-15)18-4-1-5-19(21-18)26(24,25)23-12-11-22-10-2-3-17(22)14-23/h1,4-9,17H,2-3,10-12,14H2/t17-/m0/s1 |
| InChIKey | RYRKLFPLCHDNOF-KRWDZBQOSA-N |
| XLogP | 2.09 |
| TPSA | 77.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |