C20H24N4O2S — CID 58210820
[4-[6-(3-pyrrolidin-1-ylpyrrolidin-1-yl)sulfonyl-2-pyridinyl]phenyl]methanimine (PubChem CID 58210820) has the molecular formula C20H24N4O2S and a molecular weight of 384.50 g/mol. Its IUPAC name is [4-[6-(3-pyrrolidin-1-ylpyrrolidin-1-yl)sulfonyl-2-pyridinyl]phenyl]methanimine.
| Compound Name | [4-[6-(3-pyrrolidin-1-ylpyrrolidin-1-yl)sulfonyl-2-pyridinyl]phenyl]methanimine |
|---|---|
| PubChem CID | 58210820 |
| Molecular Formula | C20H24N4O2S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.16 |
| IUPAC Name | [4-[6-(3-pyrrolidin-1-ylpyrrolidin-1-yl)sulfonyl-2-pyridinyl]phenyl]methanimine |
| SMILES | [H]/N=C/c1ccc(-c2cccc(S(=O)(=O)N3CCC(N4CCCC4)C3)n2)cc1 |
| InChI | InChI=1S/C20H24N4O2S/c21-14-16-6-8-17(9-7-16)19-4-3-5-20(22-19)27(25,26)24-13-10-18(15-24)23-11-1-2-12-23/h3-9,14,18,21H,1-2,10-13,15H2/b21-14+ |
| InChIKey | BWBNBYZTDXMSKJ-KGENOOAVSA-N |
| XLogP | 2.61 |
| TPSA | 77.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|