C7H10 — CID 58212147
5,6-ditritiobicyclo[2.2.1]hept-2-ene (PubChem CID 58212147) has the molecular formula C7H10 and a molecular weight of 98.17 g/mol. Its IUPAC name is 5,6-ditritiobicyclo[2.2.1]hept-2-ene.
| Compound Name | 5,6-ditritiobicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 58212147 |
| Molecular Formula | C7H10 |
| Molecular Weight | 98.17 g/mol |
| Exact Mass | 98.09 |
| IUPAC Name | 5,6-ditritiobicyclo[2.2.1]hept-2-ene |
| SMILES | [3H]C1C2C=CC(C2)C1[3H] |
| InChI | InChI=1S/C7H10/c1-2-7-4-3-6(1)5-7/h1-2,6-7H,3-5H2/i3T,4T |
| InChIKey | JFNLZVQOOSMTJK-PZFLKRBQSA-N |
| XLogP | 1.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.17 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|