C18H22Cl2N2O5S — CID 58218398
1-[[5-(3,5-dichlorophenyl)sulfonyl-4,4-dimethylpentoxy]methyl]pyrimidine-2,4-dione (PubChem CID 58218398) has the molecular formula C18H22Cl2N2O5S and a molecular weight of 449.36 g/mol. Its IUPAC name is 1-[[5-(3,5-dichlorophenyl)sulfonyl-4,4-dimethylpentoxy]methyl]pyrimidine-2,4-dione.
| Compound Name | 1-[[5-(3,5-dichlorophenyl)sulfonyl-4,4-dimethylpentoxy]methyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 58218398 |
| Molecular Formula | C18H22Cl2N2O5S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 1-[[5-(3,5-dichlorophenyl)sulfonyl-4,4-dimethylpentoxy]methyl]pyrimidine-2,4-dione |
| SMILES | CC(C)(CCCOCn1ccc(=O)[nH]c1=O)CS(=O)(=O)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C18H22Cl2N2O5S/c1-18(2,11-28(25,26)15-9-13(19)8-14(20)10-15)5-3-7-27-12-22-6-4-16(23)21-17(22)24/h4,6,8-10H,3,5,7,11-12H2,1-2H3,(H,21,23,24) |
| InChIKey | KBGCEUKJBGGBPM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 98.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|