C39H57MoN3P3+6 — CID 58239910
[3,5-bis(dimethylphosphaniumyl)cyclohexyl]-dimethylphosphanium;tris(2-isocyano-1,3-dimethylbenzene);molybdenum(3+) (PubChem CID 58239910) has the molecular formula C39H57MoN3P3+6 and a molecular weight of 756.77 g/mol. Its IUPAC name is [3,5-bis(dimethylphosphaniumyl)cyclohexyl]-dimethylphosphanium;tris(2-isocyano-1,3-dimethylbenzene);molybdenum(3+).
| Compound Name | [3,5-bis(dimethylphosphaniumyl)cyclohexyl]-dimethylphosphanium;tris(2-isocyano-1,3-dimethylbenzene);molybdenum(3+) |
|---|---|
| PubChem CID | 58239910 |
| Molecular Formula | C39H57MoN3P3+6 |
| Molecular Weight | 756.77 g/mol |
| Exact Mass | 758.28 |
| IUPAC Name | [3,5-bis(dimethylphosphaniumyl)cyclohexyl]-dimethylphosphanium;tris(2-isocyano-1,3-dimethylbenzene);molybdenum(3+) |
| SMILES | C[PH+](C)C1CC([PH+](C)C)CC([PH+](C)C)C1.[C-]#[N+]c1c(C)cccc1C.[C-]#[N+]c1c(C)cccc1C.[C-]#[N+]c1c(C)cccc1C.[Mo+3] |
| InChI | InChI=1S/C12H27P3.3C9H9N.Mo/c1-13(2)10-7-11(14(3)4)9-12(8-10)15(5)6;3*1-7-5-4-6-8(2)9(7)10-3;/h10-12H,7-9H2,1-6H3;3*4-6H,1-2H3;/q;;;;+3/p+3 |
| InChIKey | NUEMHMHSDARUHU-UHFFFAOYSA-Q |
| XLogP | 12.26 |
| TPSA | 13.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.77 |
| LogP ≤ 5 | 12.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|