C13H18 — CID 142971793
ethane;5-methyl-2,3-dihydronaphthalene (PubChem CID 142971793) has the molecular formula C13H18 and a molecular weight of 174.29 g/mol. Its IUPAC name is ethane;5-methyl-2,3-dihydronaphthalene.
| Compound Name | ethane;5-methyl-2,3-dihydronaphthalene |
|---|---|
| PubChem CID | 142971793 |
| Molecular Formula | C13H18 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.14 |
| IUPAC Name | ethane;5-methyl-2,3-dihydronaphthalene |
| SMILES | CC.Cc1cccc2c1=CCCC=2 |
| InChI | InChI=1S/C11H12.C2H6/c1-9-5-4-7-10-6-2-3-8-11(9)10;1-2/h4-8H,2-3H2,1H3;1-2H3 |
| InChIKey | FXJGQALJRWOVLE-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |