About CID 58245623
CID 58245623 (PubChem CID 58245623) has the molecular formula C10H10O2
and a molecular weight of 162.19 g/mol.
Molecular Properties
| Compound Name | CID 58245623 |
| PubChem CID | 58245623 |
| Molecular Formula | C10H10O2 |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.07 |
| IUPAC Name | — |
| SMILES | [CH]C(=O)Cc1ccccc1CO |
| InChI | InChI=1S/C10H10O2/c1-8(12)6-9-4-2-3-5-10(9)7-11/h1-5,11H,6-7H2 |
| InChIKey | KPRVDQZUAPPAQB-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 58245623 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58245623?
The IUPAC name of CID 58245623 (CID 58245623) is not available.
What is the SMILES notation for CID 58245623?
The canonical SMILES for CID 58245623 is [CH]C(=O)Cc1ccccc1CO.
What is the InChIKey of CID 58245623?
The InChIKey is KPRVDQZUAPPAQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10O2/c1-8(12)6-9-4-2-3-5-10(9)7-11/h1-5,11H,6-7H2.
What are the key properties of CID 58245623?
CID 58245623 has a molecular weight of 162.19 g/mol, XLogP of 1.00, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58245623 is sourced from PubChem (CID 58245623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).