C25H38O6 — CID 58265399
(4R,5R,6S)-4-[(4R)-1,3-dioxolan-4-yl]-6-ethyl-5-[(2S,3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-2-phenyl-1,3-dioxane (PubChem CID 58265399) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is (4R,5R,6S)-4-[(4R)-1,3-dioxolan-4-yl]-6-ethyl-5-[(2S,3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-2-phenyl-1,3-dioxane.
| Compound Name | (4R,5R,6S)-4-[(4R)-1,3-dioxolan-4-yl]-6-ethyl-5-[(2S,3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-2-phenyl-1,3-dioxane |
|---|---|
| PubChem CID | 58265399 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | (4R,5R,6S)-4-[(4R)-1,3-dioxolan-4-yl]-6-ethyl-5-[(2S,3R,4S,5S,6R)-6-ethyl-3,4,5-trimethyloxan-2-yl]oxy-2-phenyl-1,3-dioxane |
| SMILES | CC[C@@H]1OC(c2ccccc2)O[C@H]([C@H]2COCO2)[C@@H]1O[C@@H]1O[C@H](CC)[C@@H](C)[C@H](C)[C@H]1C |
| InChI | InChI=1S/C25H38O6/c1-6-19-16(4)15(3)17(5)24(28-19)30-22-20(7-2)29-25(18-11-9-8-10-12-18)31-23(22)21-13-26-14-27-21/h8-12,15-17,19-25H,6-7,13-14H2,1-5H3/t15-,16-,17+,19+,20-,21+,22+,23+,24-,25?/m0/s1 |
| InChIKey | CNOUPDWMTOIORC-CLOXTIBFSA-N |
| XLogP | 4.68 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |