C20H24Cl2N6O4 — CID 58280324
methyl (2S)-2-[(5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carbonyl)amino]-3-[[[(3S)-3-hydroxypyrrolidin-1-yl]-(isocyanoamino)methylidene]amino]propanoate (PubChem CID 58280324) has the molecular formula C20H24Cl2N6O4 and a molecular weight of 483.36 g/mol. Its IUPAC name is methyl (2S)-2-[(5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carbonyl)amino]-3-[[[(3S)-3-hydroxypyrrolidin-1-yl]-(isocyanoamino)methylidene]amino]propanoate.
| Compound Name | methyl (2S)-2-[(5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carbonyl)amino]-3-[[[(3S)-3-hydroxypyrrolidin-1-yl]-(isocyanoamino)methylidene]amino]propanoate |
|---|---|
| PubChem CID | 58280324 |
| Molecular Formula | C20H24Cl2N6O4 |
| Molecular Weight | 483.36 g/mol |
| Exact Mass | 482.12 |
| IUPAC Name | methyl (2S)-2-[(5,7-dichloro-1,2,3,4-tetrahydroisoquinoline-6-carbonyl)amino]-3-[[[(3S)-3-hydroxypyrrolidin-1-yl]-(isocyanoamino)methylidene]amino]propanoate |
| SMILES | [C-]#[N+]N/C(=N\C[C@H](NC(=O)c1c(Cl)cc2c(c1Cl)CCNC2)C(=O)OC)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C20H24Cl2N6O4/c1-23-27-20(28-6-4-12(29)10-28)25-9-15(19(31)32-2)26-18(30)16-14(21)7-11-8-24-5-3-13(11)17(16)22/h7,12,15,24,29H,3-6,8-10H2,2H3,(H,25,27)(H,26,30)/t12-,15-/m0/s1 |
| InChIKey | VFBNUPSHMVVVPQ-WFASDCNBSA-N |
| XLogP | 0.76 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|