C13H19N5O3S — CID 58287941
9-[(2R,3S,5R)-3,4-dimethoxy-5-(methoxymethyl)thiolan-2-yl]purin-6-amine (PubChem CID 58287941) has the molecular formula C13H19N5O3S and a molecular weight of 325.39 g/mol. Its IUPAC name is 9-[(2R,3S,5R)-3,4-dimethoxy-5-(methoxymethyl)thiolan-2-yl]purin-6-amine.
| Compound Name | 9-[(2R,3S,5R)-3,4-dimethoxy-5-(methoxymethyl)thiolan-2-yl]purin-6-amine |
|---|---|
| PubChem CID | 58287941 |
| Molecular Formula | C13H19N5O3S |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.12 |
| IUPAC Name | 9-[(2R,3S,5R)-3,4-dimethoxy-5-(methoxymethyl)thiolan-2-yl]purin-6-amine |
| SMILES | COC[C@H]1S[C@@H](n2cnc3c(N)ncnc32)[C@@H](OC)C1OC |
| InChI | InChI=1S/C13H19N5O3S/c1-19-4-7-9(20-2)10(21-3)13(22-7)18-6-17-8-11(14)15-5-16-12(8)18/h5-7,9-10,13H,4H2,1-3H3,(H2,14,15,16)/t7-,9?,10+,13-/m1/s1 |
| InChIKey | MGCOALUDYSFRFC-CXOKJZQJSA-N |
| XLogP | 0.70 |
| TPSA | 97.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |