C34H32BrF3N2O3 — CID 58304193
(4R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-4-(5-bromo-2-fluorophenyl)-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine (PubChem CID 58304193) has the molecular formula C34H32BrF3N2O3 and a molecular weight of 653.54 g/mol. Its IUPAC name is (4R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-4-(5-bromo-2-fluorophenyl)-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine.
| Compound Name | (4R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-4-(5-bromo-2-fluorophenyl)-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 58304193 |
| Molecular Formula | C34H32BrF3N2O3 |
| Molecular Weight | 653.54 g/mol |
| Exact Mass | 652.15 |
| IUPAC Name | (4R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-4-(5-bromo-2-fluorophenyl)-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine |
| SMILES | COc1ccc(C(NC2=N[C@](C)(c3cc(Br)ccc3F)C(F)(F)C(C)(C)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C34H32BrF3N2O3/c1-31(2)34(37,38)32(3,28-21-25(35)15-20-29(28)36)39-30(43-31)40-33(22-9-7-6-8-10-22,23-11-16-26(41-4)17-12-23)24-13-18-27(42-5)19-14-24/h6-21H,1-5H3,(H,39,40)/t32-/m1/s1 |
| InChIKey | UIMRGJNWERLDBK-JGCGQSQUSA-N |
| XLogP | 8.20 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.54 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|