C40H37ClF3N3O3 — CID 71009160
(4R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-4-[5-(2-chloroanilino)-2-fluorophenyl]-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine (PubChem CID 71009160) has the molecular formula C40H37ClF3N3O3 and a molecular weight of 700.20 g/mol. Its IUPAC name is (4R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-4-[5-(2-chloroanilino)-2-fluorophenyl]-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine.
| Compound Name | (4R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-4-[5-(2-chloroanilino)-2-fluorophenyl]-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine |
|---|---|
| PubChem CID | 71009160 |
| Molecular Formula | C40H37ClF3N3O3 |
| Molecular Weight | 700.20 g/mol |
| Exact Mass | 699.25 |
| IUPAC Name | (4R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-4-[5-(2-chloroanilino)-2-fluorophenyl]-5,5-difluoro-4,6,6-trimethyl-1,3-oxazin-2-amine |
| SMILES | COc1ccc(C(NC2=N[C@](C)(c3cc(Nc4ccccc4Cl)ccc3F)C(F)(F)C(C)(C)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H37ClF3N3O3/c1-37(2)40(43,44)38(3,32-25-29(19-24-34(32)42)45-35-14-10-9-13-33(35)41)46-36(50-37)47-39(26-11-7-6-8-12-26,27-15-20-30(48-4)21-16-27)28-17-22-31(49-5)23-18-28/h6-25,45H,1-5H3,(H,46,47)/t38-/m1/s1 |
| InChIKey | OIHRZWNZDWAWSJ-KXQOOQHDSA-N |
| XLogP | 9.84 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 700.20 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|