C39H44BrF3N2O3 — CID 158116589
(4S)-N-[bis(4-methoxyphenyl)-phenylmethyl]-4-(5-bromo-2-fluorophenyl)-4-(difluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine;heptane (PubChem CID 158116589) has the molecular formula C39H44BrF3N2O3 and a molecular weight of 725.69 g/mol. Its IUPAC name is (4S)-N-[bis(4-methoxyphenyl)-phenylmethyl]-4-(5-bromo-2-fluorophenyl)-4-(difluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine;heptane.
| Compound Name | (4S)-N-[bis(4-methoxyphenyl)-phenylmethyl]-4-(5-bromo-2-fluorophenyl)-4-(difluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine;heptane |
|---|---|
| PubChem CID | 158116589 |
| Molecular Formula | C39H44BrF3N2O3 |
| Molecular Weight | 725.69 g/mol |
| Exact Mass | 724.25 |
| IUPAC Name | (4S)-N-[bis(4-methoxyphenyl)-phenylmethyl]-4-(5-bromo-2-fluorophenyl)-4-(difluoromethyl)-5,6-dihydro-1,3-oxazin-2-amine;heptane |
| SMILES | CCCCCCC.COc1ccc(C(NC2=N[C@@](c3cc(Br)ccc3F)(C(F)F)CCO2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H28BrF3N2O3.C7H16/c1-39-25-13-8-22(9-14-25)32(21-6-4-3-5-7-21,23-10-15-26(40-2)16-11-23)38-30-37-31(29(35)36,18-19-41-30)27-20-24(33)12-17-28(27)34;1-3-5-7-6-4-2/h3-17,20,29H,18-19H2,1-2H3,(H,37,38);3-7H2,1-2H3/t31-;/m0./s1 |
| InChIKey | FRBVNVFXKWWPMS-YNMZEGNTSA-N |
| XLogP | 10.40 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.69 |
| LogP ≤ 5 | 10.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|