C32H30BrFN2O3 — CID 66931613
(5R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-5-(5-bromo-2-fluorophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine (PubChem CID 66931613) has the molecular formula C32H30BrFN2O3 and a molecular weight of 589.51 g/mol. Its IUPAC name is (5R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-5-(5-bromo-2-fluorophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine.
| Compound Name | (5R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-5-(5-bromo-2-fluorophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine |
|---|---|
| PubChem CID | 66931613 |
| Molecular Formula | C32H30BrFN2O3 |
| Molecular Weight | 589.51 g/mol |
| Exact Mass | 588.14 |
| IUPAC Name | (5R)-N-[bis(4-methoxyphenyl)-phenylmethyl]-5-(5-bromo-2-fluorophenyl)-5-methyl-2,6-dihydro-1,4-oxazin-3-amine |
| SMILES | COc1ccc(C(NC2=N[C@](C)(c3cc(Br)ccc3F)COC2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C32H30BrFN2O3/c1-31(28-19-25(33)13-18-29(28)34)21-39-20-30(35-31)36-32(22-7-5-4-6-8-22,23-9-14-26(37-2)15-10-23)24-11-16-27(38-3)17-12-24/h4-19H,20-21H2,1-3H3,(H,35,36)/t31-/m0/s1 |
| InChIKey | IDGRZYUCCDMRDD-HKBQPEDESA-N |
| XLogP | 6.83 |
| TPSA | 52.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.51 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|